ChemNet > CAS > 175201-66-8 2-({[2-(ethylthio)-3-pyridyl]carbonyl}amino)-4-(methylthio)butanoic acid
175201-66-8 2-({[2-(ethylthio)-3-pyridyl]carbonyl}amino)-4-(methylthio)butanoic acid
| product Name |
2-({[2-(ethylthio)-3-pyridyl]carbonyl}amino)-4-(methylthio)butanoic acid |
| CAS No |
175201-66-8 |
| Synonyms |
N-{[2-(ethylsulfanyl)pyridin-3-yl]carbonyl}methionine |
| Molecular Formula |
C13H18N2O3S2 |
| Molecular Weight |
314.4236 |
| InChI |
InChI=1/C13H18N2O3S2/c1-3-20-12-9(5-4-7-14-12)11(16)15-10(13(17)18)6-8-19-2/h4-5,7,10H,3,6,8H2,1-2H3,(H,15,16)(H,17,18) |
| Molecular Structure |
|
| Density |
1.3g/cm3 |
| Melting point |
121℃ |
| Boiling point |
575.8°C at 760 mmHg |
| Refractive index |
1.603 |
| Flash point |
302°C |
| Vapour Pressur |
4.24E-14mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|